C16H22N4O4S2 — CID 100648037
N-[5-[[(1S)-1-(2-methoxyphenyl)ethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 100648037) has the molecular formula C16H22N4O4S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[5-[[(1S)-1-(2-methoxyphenyl)ethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[[(1S)-1-(2-methoxyphenyl)ethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100648037 |
| Molecular Formula | C16H22N4O4S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-[5-[[(1S)-1-(2-methoxyphenyl)ethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccccc1[C@H](C)NS(=O)(=O)c1nnc(NC(=O)C(C)(C)C)s1 |
| InChI | InChI=1S/C16H22N4O4S2/c1-10(11-8-6-7-9-12(11)24-5)20-26(22,23)15-19-18-14(25-15)17-13(21)16(2,3)4/h6-10,20H,1-5H3,(H,17,18,21)/t10-/m0/s1 |
| InChIKey | VKZMSPJFFSBLAH-JTQLQIEISA-N |
| XLogP | 2.57 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|