C15H20N4O3S3 — CID 100586107
N-[5-[(2-ethylsulfanylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 100586107) has the molecular formula C15H20N4O3S3 and a molecular weight of 400.55 g/mol. Its IUPAC name is N-[5-[(2-ethylsulfanylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[(2-ethylsulfanylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100586107 |
| Molecular Formula | C15H20N4O3S3 |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N-[5-[(2-ethylsulfanylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | CCSc1ccccc1NS(=O)(=O)c1nnc(NC(=O)C(C)(C)C)s1 |
| InChI | InChI=1S/C15H20N4O3S3/c1-5-23-11-9-7-6-8-10(11)19-25(21,22)14-18-17-13(24-14)16-12(20)15(2,3)4/h6-9,19H,5H2,1-4H3,(H,16,17,20) |
| InChIKey | VALHGOCVRUFLOJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|