C17H24N4O3S2 — CID 100509135
2,2-dimethyl-N-[5-[[(1S)-1-(4-methylphenyl)propyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 100509135) has the molecular formula C17H24N4O3S2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 2,2-dimethyl-N-[5-[[(1S)-1-(4-methylphenyl)propyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[5-[[(1S)-1-(4-methylphenyl)propyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 100509135 |
| Molecular Formula | C17H24N4O3S2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2,2-dimethyl-N-[5-[[(1S)-1-(4-methylphenyl)propyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CC[C@H](NS(=O)(=O)c1nnc(NC(=O)C(C)(C)C)s1)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24N4O3S2/c1-6-13(12-9-7-11(2)8-10-12)21-26(23,24)16-20-19-15(25-16)18-14(22)17(3,4)5/h7-10,13,21H,6H2,1-5H3,(H,18,19,22)/t13-/m0/s1 |
| InChIKey | NOCOPDOEBNZSEY-ZDUSSCGKSA-N |
| XLogP | 3.26 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|