C18H26N4O3S2 — CID 133251797
N-[5-[1-(2,4-dimethylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 133251797) has the molecular formula C18H26N4O3S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is N-[5-[1-(2,4-dimethylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[1-(2,4-dimethylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 133251797 |
| Molecular Formula | C18H26N4O3S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[5-[1-(2,4-dimethylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | CCC(NS(=O)(=O)c1nnc(NC(=O)C(C)(C)C)s1)c1ccc(C)cc1C |
| InChI | InChI=1S/C18H26N4O3S2/c1-7-14(13-9-8-11(2)10-12(13)3)22-27(24,25)17-21-20-16(26-17)19-15(23)18(4,5)6/h8-10,14,22H,7H2,1-6H3,(H,19,20,23) |
| InChIKey | JIQATPGMXRRASJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|