C15H20N4O3S2 — CID 100769210
N-[5-[(2,3-dimethylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 100769210) has the molecular formula C15H20N4O3S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[5-[(2,3-dimethylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[(2,3-dimethylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100769210 |
| Molecular Formula | C15H20N4O3S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[5-[(2,3-dimethylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2nnc(NC(=O)C(C)(C)C)s2)c1C |
| InChI | InChI=1S/C15H20N4O3S2/c1-9-7-6-8-11(10(9)2)19-24(21,22)14-18-17-13(23-14)16-12(20)15(3,4)5/h6-8,19H,1-5H3,(H,16,17,20) |
| InChIKey | YADKJLSLLCMTKT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|