C13H17N5O3S2 — CID 100548695
2,2-dimethyl-N-[5-(pyridin-3-ylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 100548695) has the molecular formula C13H17N5O3S2 and a molecular weight of 355.45 g/mol. Its IUPAC name is 2,2-dimethyl-N-[5-(pyridin-3-ylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[5-(pyridin-3-ylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 100548695 |
| Molecular Formula | C13H17N5O3S2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2,2-dimethyl-N-[5-(pyridin-3-ylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CC(C)(C)C(=O)Nc1nnc(S(=O)(=O)NCc2cccnc2)s1 |
| InChI | InChI=1S/C13H17N5O3S2/c1-13(2,3)10(19)16-11-17-18-12(22-11)23(20,21)15-8-9-5-4-6-14-7-9/h4-7,15H,8H2,1-3H3,(H,16,17,19) |
| InChIKey | IRMGLQHUNUKIRK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|