C9H10N4O3S3 — CID 110779516
N-[5-(thiophen-2-ylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110779516) has the molecular formula C9H10N4O3S3 and a molecular weight of 318.41 g/mol. Its IUPAC name is N-[5-(thiophen-2-ylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-(thiophen-2-ylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110779516 |
| Molecular Formula | C9H10N4O3S3 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | N-[5-(thiophen-2-ylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)NCc2cccs2)s1 |
| InChI | InChI=1S/C9H10N4O3S3/c1-6(14)11-8-12-13-9(18-8)19(15,16)10-5-7-3-2-4-17-7/h2-4,10H,5H2,1H3,(H,11,12,14) |
| InChIKey | WFEDYFYPNRKYSG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|