C7H10N4O6S2 — CID 113383289
3-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylamino]-2-hydroxypropanoic acid (PubChem CID 113383289) has the molecular formula C7H10N4O6S2 and a molecular weight of 310.31 g/mol. Its IUPAC name is 3-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 113383289 |
| Molecular Formula | C7H10N4O6S2 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 3-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylamino]-2-hydroxypropanoic acid |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)NCC(O)C(=O)O)s1 |
| InChI | InChI=1S/C7H10N4O6S2/c1-3(12)9-6-10-11-7(18-6)19(16,17)8-2-4(13)5(14)15/h4,8,13H,2H2,1H3,(H,14,15)(H,9,10,12) |
| InChIKey | UIQKXNSXTIAVJX-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 158.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|