C9H11N5O3S3 — CID 110739067
N-[5-[(5-methyl-1,3-thiazol-2-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110739067) has the molecular formula C9H11N5O3S3 and a molecular weight of 333.42 g/mol. Its IUPAC name is N-[5-[(5-methyl-1,3-thiazol-2-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(5-methyl-1,3-thiazol-2-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110739067 |
| Molecular Formula | C9H11N5O3S3 |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | N-[5-[(5-methyl-1,3-thiazol-2-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)NCc2ncc(C)s2)s1 |
| InChI | InChI=1S/C9H11N5O3S3/c1-5-3-10-7(18-5)4-11-20(16,17)9-14-13-8(19-9)12-6(2)15/h3,11H,4H2,1-2H3,(H,12,13,15) |
| InChIKey | DXBVLXZXUUKXJH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|