C13H12N6O3S3 — CID 110318005
N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110318005) has the molecular formula C13H12N6O3S3 and a molecular weight of 396.48 g/mol. Its IUPAC name is N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110318005 |
| Molecular Formula | C13H12N6O3S3 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)NCc2nc(-c3ccccn3)cs2)s1 |
| InChI | InChI=1S/C13H12N6O3S3/c1-8(20)16-12-18-19-13(24-12)25(21,22)15-6-11-17-10(7-23-11)9-4-2-3-5-14-9/h2-5,7,15H,6H2,1H3,(H,16,18,20) |
| InChIKey | VDHGYNCNWKOIER-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|