C11H21N5O3S2 — CID 106141866
N-[5-[(5-amino-2,2-dimethylpentyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 106141866) has the molecular formula C11H21N5O3S2 and a molecular weight of 335.46 g/mol. Its IUPAC name is N-[5-[(5-amino-2,2-dimethylpentyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(5-amino-2,2-dimethylpentyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 106141866 |
| Molecular Formula | C11H21N5O3S2 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[5-[(5-amino-2,2-dimethylpentyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)NCC(C)(C)CCCN)s1 |
| InChI | InChI=1S/C11H21N5O3S2/c1-8(17)14-9-15-16-10(20-9)21(18,19)13-7-11(2,3)5-4-6-12/h13H,4-7,12H2,1-3H3,(H,14,15,17) |
| InChIKey | VJAAOVZWUAOYPV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|