C7H12N4O5S2 — CID 110417348
N-[5-(2-methoxyethoxysulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110417348) has the molecular formula C7H12N4O5S2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[5-(2-methoxyethoxysulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-(2-methoxyethoxysulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110417348 |
| Molecular Formula | C7H12N4O5S2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N-[5-(2-methoxyethoxysulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COCCONS(=O)(=O)c1nnc(NC(C)=O)s1 |
| InChI | InChI=1S/C7H12N4O5S2/c1-5(12)8-6-9-10-7(17-6)18(13,14)11-16-4-3-15-2/h11H,3-4H2,1-2H3,(H,8,9,12) |
| InChIKey | PQGMQHIIGVGQSS-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|