C10H16N4O5S2 — CID 107145053
(2S)-2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylamino]hexanoic acid (PubChem CID 107145053) has the molecular formula C10H16N4O5S2 and a molecular weight of 336.40 g/mol. Its IUPAC name is (2S)-2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylamino]hexanoic acid.
| Compound Name | (2S)-2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 107145053 |
| Molecular Formula | C10H16N4O5S2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | (2S)-2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylamino]hexanoic acid |
| SMILES | CCCC[C@H](NS(=O)(=O)c1nnc(NC(C)=O)s1)C(=O)O |
| InChI | InChI=1S/C10H16N4O5S2/c1-3-4-5-7(8(16)17)14-21(18,19)10-13-12-9(20-10)11-6(2)15/h7,14H,3-5H2,1-2H3,(H,16,17)(H,11,12,15)/t7-/m0/s1 |
| InChIKey | LUKNEHWQXFFGOD-ZETCQYMHSA-N |
| XLogP | 0.42 |
| TPSA | 138.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|