C9H16N4O4S3 — CID 106157438
N-[5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 106157438) has the molecular formula C9H16N4O4S3 and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 106157438 |
| Molecular Formula | C9H16N4O4S3 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | N-[5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CSC(CO)C(C)NS(=O)(=O)c1nnc(NC(C)=O)s1 |
| InChI | InChI=1S/C9H16N4O4S3/c1-5(7(4-14)18-3)13-20(16,17)9-12-11-8(19-9)10-6(2)15/h5,7,13-14H,4H2,1-3H3,(H,10,11,15) |
| InChIKey | DPRBGWVIZTWSFD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|