C8H13ClN4O3S2 — CID 113383322
N-[5-[(1-chloro-2-methylpropan-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 113383322) has the molecular formula C8H13ClN4O3S2 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-[5-[(1-chloro-2-methylpropan-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(1-chloro-2-methylpropan-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 113383322 |
| Molecular Formula | C8H13ClN4O3S2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | N-[5-[(1-chloro-2-methylpropan-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)NC(C)(C)CCl)s1 |
| InChI | InChI=1S/C8H13ClN4O3S2/c1-5(14)10-6-11-12-7(17-6)18(15,16)13-8(2,3)4-9/h13H,4H2,1-3H3,(H,10,11,14) |
| InChIKey | BDOSWSAJURMUNZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|