C12H14Cl3NO4S — CID 43470072
2-[(2,4,6-trichlorophenyl)sulfonylamino]hexanoic acid (PubChem CID 43470072) has the molecular formula C12H14Cl3NO4S and a molecular weight of 374.67 g/mol. Its IUPAC name is 2-[(2,4,6-trichlorophenyl)sulfonylamino]hexanoic acid.
| Compound Name | 2-[(2,4,6-trichlorophenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 43470072 |
| Molecular Formula | C12H14Cl3NO4S |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 2-[(2,4,6-trichlorophenyl)sulfonylamino]hexanoic acid |
| SMILES | CCCCC(NS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H14Cl3NO4S/c1-2-3-4-10(12(17)18)16-21(19,20)11-8(14)5-7(13)6-9(11)15/h5-6,10,16H,2-4H2,1H3,(H,17,18) |
| InChIKey | PKLGEWZZVYPSDT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |