C10H8Cl3NO6S — CID 112733165
(2S)-2-[(2,4,6-trichlorophenyl)sulfonylamino]butanedioic acid (PubChem CID 112733165) has the molecular formula C10H8Cl3NO6S and a molecular weight of 376.60 g/mol. Its IUPAC name is (2S)-2-[(2,4,6-trichlorophenyl)sulfonylamino]butanedioic acid.
| Compound Name | (2S)-2-[(2,4,6-trichlorophenyl)sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 112733165 |
| Molecular Formula | C10H8Cl3NO6S |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 374.91 |
| IUPAC Name | (2S)-2-[(2,4,6-trichlorophenyl)sulfonylamino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C10H8Cl3NO6S/c11-4-1-5(12)9(6(13)2-4)21(19,20)14-7(10(17)18)3-8(15)16/h1-2,7,14H,3H2,(H,15,16)(H,17,18)/t7-/m0/s1 |
| InChIKey | DLTPNQSAEVQARL-ZETCQYMHSA-N |
| XLogP | 1.85 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |