C10H9Br2NO6S — CID 42080975
(2R)-2-[(2,5-dibromophenyl)sulfonylamino]butanedioic acid (PubChem CID 42080975) has the molecular formula C10H9Br2NO6S and a molecular weight of 431.06 g/mol. Its IUPAC name is (2R)-2-[(2,5-dibromophenyl)sulfonylamino]butanedioic acid.
| Compound Name | (2R)-2-[(2,5-dibromophenyl)sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 42080975 |
| Molecular Formula | C10H9Br2NO6S |
| Molecular Weight | 431.06 g/mol |
| Exact Mass | 428.85 |
| IUPAC Name | (2R)-2-[(2,5-dibromophenyl)sulfonylamino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](NS(=O)(=O)c1cc(Br)ccc1Br)C(=O)O |
| InChI | InChI=1S/C10H9Br2NO6S/c11-5-1-2-6(12)8(3-5)20(18,19)13-7(10(16)17)4-9(14)15/h1-3,7,13H,4H2,(H,14,15)(H,16,17)/t7-/m1/s1 |
| InChIKey | QHMULILFQFNFLV-SSDOTTSWSA-N |
| XLogP | 1.42 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.06 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |