C10H10ClNO6S — CID 71628754
2-[(2-chlorophenyl)sulfonylamino]butanedioic acid (PubChem CID 71628754) has the molecular formula C10H10ClNO6S and a molecular weight of 307.71 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)sulfonylamino]butanedioic acid.
| Compound Name | 2-[(2-chlorophenyl)sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 71628754 |
| Molecular Formula | C10H10ClNO6S |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-[(2-chlorophenyl)sulfonylamino]butanedioic acid |
| SMILES | O=C(O)CC(NS(=O)(=O)c1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C10H10ClNO6S/c11-6-3-1-2-4-8(6)19(17,18)12-7(10(15)16)5-9(13)14/h1-4,7,12H,5H2,(H,13,14)(H,15,16) |
| InChIKey | RJIMIINRZARYRV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |