C10H10N2O8S — CID 53474586
(2S)-2-[(2-nitrophenyl)sulfonylamino]butanedioic acid (PubChem CID 53474586) has the molecular formula C10H10N2O8S and a molecular weight of 318.26 g/mol. Its IUPAC name is (2S)-2-[(2-nitrophenyl)sulfonylamino]butanedioic acid.
| Compound Name | (2S)-2-[(2-nitrophenyl)sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 53474586 |
| Molecular Formula | C10H10N2O8S |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | (2S)-2-[(2-nitrophenyl)sulfonylamino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H10N2O8S/c13-9(14)5-6(10(15)16)11-21(19,20)8-4-2-1-3-7(8)12(17)18/h1-4,6,11H,5H2,(H,13,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | AAVZAXHDSZKDFT-LURJTMIESA-N |
| XLogP | -0.20 |
| TPSA | 163.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|