C27H27N3O8S — CID 86604341
(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-nitrophenyl)sulfonylamino]hexanoic acid (PubChem CID 86604341) has the molecular formula C27H27N3O8S and a molecular weight of 553.59 g/mol. Its IUPAC name is (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-nitrophenyl)sulfonylamino]hexanoic acid.
| Compound Name | (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-nitrophenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 86604341 |
| Molecular Formula | C27H27N3O8S |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-nitrophenyl)sulfonylamino]hexanoic acid |
| SMILES | O=C(NCCCC[C@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H27N3O8S/c31-26(32)23(29-39(36,37)25-15-6-5-14-24(25)30(34)35)13-7-8-16-28-27(33)38-17-22-20-11-3-1-9-18(20)19-10-2-4-12-21(19)22/h1-6,9-12,14-15,22-23,29H,7-8,13,16-17H2,(H,28,33)(H,31,32)/t23-/m0/s1 |
| InChIKey | JKCRDYXPJFKBCY-QHCPKHFHSA-N |
| XLogP | 4.04 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|