C22H25NO4 — CID 90132724
(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhexanoic acid (PubChem CID 90132724) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhexanoic acid.
| Compound Name | (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhexanoic acid |
|---|---|
| PubChem CID | 90132724 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhexanoic acid |
| SMILES | C[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H25NO4/c1-15(21(24)25)8-6-7-13-23-22(26)27-14-20-18-11-4-2-9-16(18)17-10-3-5-12-19(17)20/h2-5,9-12,15,20H,6-8,13-14H2,1H3,(H,23,26)(H,24,25)/t15-/m0/s1 |
| InChIKey | CKZUKJLVUDLVMC-HNNXBMFYSA-N |
| XLogP | 4.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|