C21H25NO4 — CID 22492775
9H-fluoren-9-ylmethyl N-(5,6-dihydroxyhexyl)carbamate (PubChem CID 22492775) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(5,6-dihydroxyhexyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(5,6-dihydroxyhexyl)carbamate |
|---|---|
| PubChem CID | 22492775 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(5,6-dihydroxyhexyl)carbamate |
| SMILES | O=C(NCCCCC(O)CO)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H25NO4/c23-13-15(24)7-5-6-12-22-21(25)26-14-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-4,8-11,15,20,23-24H,5-7,12-14H2,(H,22,25) |
| InChIKey | SLKCKAQUPVULLX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|