C21H25NO5 — CID 58969842
9H-fluoren-9-ylmethyl N-[3-(2,3-dihydroxypropoxy)propyl]carbamate (PubChem CID 58969842) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,3-dihydroxypropoxy)propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,3-dihydroxypropoxy)propyl]carbamate |
|---|---|
| PubChem CID | 58969842 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,3-dihydroxypropoxy)propyl]carbamate |
| SMILES | O=C(NCCCOCC(O)CO)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H25NO5/c23-12-15(24)13-26-11-5-10-22-21(25)27-14-20-18-8-3-1-6-16(18)17-7-2-4-9-19(17)20/h1-4,6-9,15,20,23-24H,5,10-14H2,(H,22,25) |
| InChIKey | FUIAOWXKQFZZDT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|