C19H19F2NO2 — CID 164675149
9H-fluoren-9-ylmethyl N-(4,4-difluorobutyl)carbamate (PubChem CID 164675149) has the molecular formula C19H19F2NO2 and a molecular weight of 331.36 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(4,4-difluorobutyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(4,4-difluorobutyl)carbamate |
|---|---|
| PubChem CID | 164675149 |
| Molecular Formula | C19H19F2NO2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(4,4-difluorobutyl)carbamate |
| SMILES | O=C(NCCCC(F)F)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H19F2NO2/c20-18(21)10-5-11-22-19(23)24-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17/h1-4,6-9,17-18H,5,10-12H2,(H,22,23) |
| InChIKey | KFEWNQHSRBSCES-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|