C38H38N2O6 — CID 156889446
5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]pentanoic acid (PubChem CID 156889446) has the molecular formula C38H38N2O6 and a molecular weight of 618.73 g/mol. Its IUPAC name is 5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]pentanoic acid.
| Compound Name | 5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]pentanoic acid |
|---|---|
| PubChem CID | 156889446 |
| Molecular Formula | C38H38N2O6 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | 5-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]pentanoic acid |
| SMILES | O=C(NCCCC(CCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H38N2O6/c41-36(42)25(11-9-21-39-37(43)45-23-34-30-17-5-1-13-26(30)27-14-2-6-18-31(27)34)12-10-22-40-38(44)46-24-35-32-19-7-3-15-28(32)29-16-4-8-20-33(29)35/h1-8,13-20,25,34-35H,9-12,21-24H2,(H,39,43)(H,40,44)(H,41,42) |
| InChIKey | MGCSXTAWMLYJRH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|