C9H10N2O6S — CID 767456
(2S)-2-[(2-nitrophenyl)sulfonylamino]propanoic acid (PubChem CID 767456) has the molecular formula C9H10N2O6S and a molecular weight of 274.25 g/mol. Its IUPAC name is (2S)-2-[(2-nitrophenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[(2-nitrophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 767456 |
| Molecular Formula | C9H10N2O6S |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | (2S)-2-[(2-nitrophenyl)sulfonylamino]propanoic acid |
| SMILES | C[C@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H10N2O6S/c1-6(9(12)13)10-18(16,17)8-5-3-2-4-7(8)11(14)15/h2-6,10H,1H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | IFHSAIAIMGLJBS-LURJTMIESA-N |
| XLogP | 0.35 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|