C18H20N4O9S2 — CID 177433554
2-nitro-N-[(2R,3R)-3-[(2-nitrophenyl)sulfonylamino]-4-oxohexan-2-yl]benzenesulfonamide (PubChem CID 177433554) has the molecular formula C18H20N4O9S2 and a molecular weight of 500.51 g/mol. Its IUPAC name is 2-nitro-N-[(2R,3R)-3-[(2-nitrophenyl)sulfonylamino]-4-oxohexan-2-yl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[(2R,3R)-3-[(2-nitrophenyl)sulfonylamino]-4-oxohexan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 177433554 |
| Molecular Formula | C18H20N4O9S2 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | 2-nitro-N-[(2R,3R)-3-[(2-nitrophenyl)sulfonylamino]-4-oxohexan-2-yl]benzenesulfonamide |
| SMILES | CCC(=O)[C@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])[C@@H](C)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N4O9S2/c1-3-15(23)18(20-33(30,31)17-11-7-5-9-14(17)22(26)27)12(2)19-32(28,29)16-10-6-4-8-13(16)21(24)25/h4-12,18-20H,3H2,1-2H3/t12-,18-/m1/s1 |
| InChIKey | SRVSYSVTUHKWAX-KZULUSFZSA-N |
| XLogP | 1.50 |
| TPSA | 195.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|