C18H19N3O7S — CID 16743178
N-[(1R,2R)-2-methyl-1-(4-nitrophenyl)-3-oxopentyl]-2-nitrobenzenesulfonamide (PubChem CID 16743178) has the molecular formula C18H19N3O7S and a molecular weight of 421.43 g/mol. Its IUPAC name is N-[(1R,2R)-2-methyl-1-(4-nitrophenyl)-3-oxopentyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-methyl-1-(4-nitrophenyl)-3-oxopentyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 16743178 |
| Molecular Formula | C18H19N3O7S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[(1R,2R)-2-methyl-1-(4-nitrophenyl)-3-oxopentyl]-2-nitrobenzenesulfonamide |
| SMILES | CCC(=O)[C@H](C)[C@@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19N3O7S/c1-3-16(22)12(2)18(13-8-10-14(11-9-13)20(23)24)19-29(27,28)17-7-5-4-6-15(17)21(25)26/h4-12,18-19H,3H2,1-2H3/t12-,18+/m0/s1 |
| InChIKey | ZLLRYWJRDNHHJN-KPZWWZAWSA-N |
| XLogP | 3.14 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|