C22H19FN4O10S2 — CID 177453840
methyl (2R,3R)-3-(4-fluorophenyl)-2,3-bis[(2-nitrophenyl)sulfonylamino]propanoate (PubChem CID 177453840) has the molecular formula C22H19FN4O10S2 and a molecular weight of 582.54 g/mol. Its IUPAC name is methyl (2R,3R)-3-(4-fluorophenyl)-2,3-bis[(2-nitrophenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2R,3R)-3-(4-fluorophenyl)-2,3-bis[(2-nitrophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 177453840 |
| Molecular Formula | C22H19FN4O10S2 |
| Molecular Weight | 582.54 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | methyl (2R,3R)-3-(4-fluorophenyl)-2,3-bis[(2-nitrophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])[C@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19FN4O10S2/c1-37-22(28)21(25-39(35,36)19-9-5-3-7-17(19)27(31)32)20(14-10-12-15(23)13-11-14)24-38(33,34)18-8-4-2-6-16(18)26(29)30/h2-13,20-21,24-25H,1H3/t20-,21-/m1/s1 |
| InChIKey | XYCXACRANWEBAL-NHCUHLMSSA-N |
| XLogP | 2.18 |
| TPSA | 204.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|