C18H20N2O7S — CID 96527787
methyl (2R,3R)-3-[(4-methoxy-2-nitrophenyl)sulfonylamino]-2-methyl-3-phenylpropanoate (PubChem CID 96527787) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is methyl (2R,3R)-3-[(4-methoxy-2-nitrophenyl)sulfonylamino]-2-methyl-3-phenylpropanoate.
| Compound Name | methyl (2R,3R)-3-[(4-methoxy-2-nitrophenyl)sulfonylamino]-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 96527787 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | methyl (2R,3R)-3-[(4-methoxy-2-nitrophenyl)sulfonylamino]-2-methyl-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](NS(=O)(=O)c1ccc(OC)cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H20N2O7S/c1-12(18(21)27-3)17(13-7-5-4-6-8-13)19-28(24,25)16-10-9-14(26-2)11-15(16)20(22)23/h4-12,17,19H,1-3H3/t12-,17-/m1/s1 |
| InChIKey | GYSGNHFVCYBQSW-SJKOYZFVSA-N |
| XLogP | 2.43 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|