C9H10N2O8S — CID 60713550
2-[(4-methoxy-2-nitrophenyl)sulfonylamino]oxyacetic acid (PubChem CID 60713550) has the molecular formula C9H10N2O8S and a molecular weight of 306.25 g/mol. Its IUPAC name is 2-[(4-methoxy-2-nitrophenyl)sulfonylamino]oxyacetic acid.
| Compound Name | 2-[(4-methoxy-2-nitrophenyl)sulfonylamino]oxyacetic acid |
|---|---|
| PubChem CID | 60713550 |
| Molecular Formula | C9H10N2O8S |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-[(4-methoxy-2-nitrophenyl)sulfonylamino]oxyacetic acid |
| SMILES | COc1ccc(S(=O)(=O)NOCC(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10N2O8S/c1-18-6-2-3-8(7(4-6)11(14)15)20(16,17)10-19-5-9(12)13/h2-4,10H,5H2,1H3,(H,12,13) |
| InChIKey | FAOOWWCEZQXCFH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|