C7H6NNaO6S — CID 112704965
sodium 4-methoxy-2-nitrobenzenesulfonate (PubChem CID 112704965) has the molecular formula C7H6NNaO6S and a molecular weight of 255.18 g/mol. Its IUPAC name is sodium 4-methoxy-2-nitrobenzenesulfonate.
| Compound Name | sodium 4-methoxy-2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 112704965 |
| Molecular Formula | C7H6NNaO6S |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | sodium 4-methoxy-2-nitrobenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)[O-])c([N+](=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C7H7NO6S.Na/c1-14-5-2-3-7(15(11,12)13)6(4-5)8(9)10;/h2-4H,1H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | BCVUXOUXNFPURU-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 109.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|