C10H12F2N2O6S — CID 104858875
N-(2,2-difluoro-3-hydroxypropyl)-4-methoxy-2-nitrobenzenesulfonamide (PubChem CID 104858875) has the molecular formula C10H12F2N2O6S and a molecular weight of 326.28 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-4-methoxy-2-nitrobenzenesulfonamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-4-methoxy-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 104858875 |
| Molecular Formula | C10H12F2N2O6S |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-4-methoxy-2-nitrobenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(F)(F)CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H12F2N2O6S/c1-20-7-2-3-9(8(4-7)14(16)17)21(18,19)13-5-10(11,12)6-15/h2-4,13,15H,5-6H2,1H3 |
| InChIKey | BHQLIVCAOMYYGL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|