C15H13F3N2O5S — CID 31068808
4-methoxy-2-nitro-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 31068808) has the molecular formula C15H13F3N2O5S and a molecular weight of 390.34 g/mol. Its IUPAC name is 4-methoxy-2-nitro-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-2-nitro-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 31068808 |
| Molecular Formula | C15H13F3N2O5S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 4-methoxy-2-nitro-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2cccc(C(F)(F)F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13F3N2O5S/c1-25-12-5-6-14(13(8-12)20(21)22)26(23,24)19-9-10-3-2-4-11(7-10)15(16,17)18/h2-8,19H,9H2,1H3 |
| InChIKey | SUBGTQCZDSVVIY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|