C13H11F3N4O5S — CID 18148096
4-methoxy-2-nitro-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide (PubChem CID 18148096) has the molecular formula C13H11F3N4O5S and a molecular weight of 392.32 g/mol. Its IUPAC name is 4-methoxy-2-nitro-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide.
| Compound Name | 4-methoxy-2-nitro-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 18148096 |
| Molecular Formula | C13H11F3N4O5S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 4-methoxy-2-nitro-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide |
| SMILES | COc1ccc(S(=O)(=O)NNc2ccc(C(F)(F)F)cn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11F3N4O5S/c1-25-9-3-4-11(10(6-9)20(21)22)26(23,24)19-18-12-5-2-8(7-17-12)13(14,15)16/h2-7,19H,1H3,(H,17,18) |
| InChIKey | NTRBLIMPZWPGBD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|