C12H9BrF3N3O2S — CID 8505642
2-bromo-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide (PubChem CID 8505642) has the molecular formula C12H9BrF3N3O2S and a molecular weight of 396.19 g/mol. Its IUPAC name is 2-bromo-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide.
| Compound Name | 2-bromo-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 8505642 |
| Molecular Formula | C12H9BrF3N3O2S |
| Molecular Weight | 396.19 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | 2-bromo-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide |
| SMILES | O=S(=O)(NNc1ccc(C(F)(F)F)cn1)c1ccccc1Br |
| InChI | InChI=1S/C12H9BrF3N3O2S/c13-9-3-1-2-4-10(9)22(20,21)19-18-11-6-5-8(7-17-11)12(14,15)16/h1-7,19H,(H,17,18) |
| InChIKey | LPTVARXOEFGFIQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|