C14H11ClF3N3O2S — CID 8505649
(E)-2-(4-chlorophenyl)-N'-[5-(trifluoromethyl)-2-pyridinyl]ethenesulfonohydrazide (PubChem CID 8505649) has the molecular formula C14H11ClF3N3O2S and a molecular weight of 377.78 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-N'-[5-(trifluoromethyl)-2-pyridinyl]ethenesulfonohydrazide.
| Compound Name | (E)-2-(4-chlorophenyl)-N'-[5-(trifluoromethyl)-2-pyridinyl]ethenesulfonohydrazide |
|---|---|
| PubChem CID | 8505649 |
| Molecular Formula | C14H11ClF3N3O2S |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-N'-[5-(trifluoromethyl)-2-pyridinyl]ethenesulfonohydrazide |
| SMILES | O=S(=O)(/C=C/c1ccc(Cl)cc1)NNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H11ClF3N3O2S/c15-12-4-1-10(2-5-12)7-8-24(22,23)21-20-13-6-3-11(9-19-13)14(16,17)18/h1-9,21H,(H,19,20)/b8-7+ |
| InChIKey | BQWQCYDGQWWAKX-BQYQJAHWSA-N |
| XLogP | 3.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|