C16H13ClF3NO2S — CID 32940502
(E)-2-(4-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethenesulfonamide (PubChem CID 32940502) has the molecular formula C16H13ClF3NO2S and a molecular weight of 375.80 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethenesulfonamide.
| Compound Name | (E)-2-(4-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 32940502 |
| Molecular Formula | C16H13ClF3NO2S |
| Molecular Weight | 375.80 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccc(Cl)cc1)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13ClF3NO2S/c17-15-6-4-12(5-7-15)8-9-24(22,23)21-11-13-2-1-3-14(10-13)16(18,19)20/h1-10,21H,11H2/b9-8+ |
| InChIKey | AERVYXGRDDCCPT-CMDGGOBGSA-N |
| XLogP | 4.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.80 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |