C18H22ClN2O2S+ — CID 9191409
[4-[[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]methyl]phenyl]methyl-dimethylazanium (PubChem CID 9191409) has the molecular formula C18H22ClN2O2S+ and a molecular weight of 365.91 g/mol. Its IUPAC name is [4-[[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]methyl]phenyl]methyl-dimethylazanium.
| Compound Name | [4-[[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]methyl]phenyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 9191409 |
| Molecular Formula | C18H22ClN2O2S+ |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [4-[[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]methyl]phenyl]methyl-dimethylazanium |
| SMILES | C[NH+](C)Cc1ccc(CNS(=O)(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-21(2)14-17-5-3-16(4-6-17)13-20-24(22,23)12-11-15-7-9-18(19)10-8-15/h3-12,20H,13-14H2,1-2H3/p+1/b12-11+ |
| InChIKey | FSJDUZNAEQGNHV-VAWYXSNFSA-O |
| XLogP | 2.07 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |