C16H19ClFN2O2S+ — CID 9191387
[4-[[(4-chloro-2-fluorophenyl)sulfonylamino]methyl]phenyl]methyl-dimethylazanium (PubChem CID 9191387) has the molecular formula C16H19ClFN2O2S+ and a molecular weight of 357.86 g/mol. Its IUPAC name is [4-[[(4-chloro-2-fluorophenyl)sulfonylamino]methyl]phenyl]methyl-dimethylazanium.
| Compound Name | [4-[[(4-chloro-2-fluorophenyl)sulfonylamino]methyl]phenyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 9191387 |
| Molecular Formula | C16H19ClFN2O2S+ |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [4-[[(4-chloro-2-fluorophenyl)sulfonylamino]methyl]phenyl]methyl-dimethylazanium |
| SMILES | C[NH+](C)Cc1ccc(CNS(=O)(=O)c2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C16H18ClFN2O2S/c1-20(2)11-13-5-3-12(4-6-13)10-19-23(21,22)16-8-7-14(17)9-15(16)18/h3-9,19H,10-11H2,1-2H3/p+1 |
| InChIKey | RAZCGUPDEQBOGF-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |