C10H11ClFNO2S — CID 114616583
4-chloro-2-fluoro-N-(2-methylprop-2-enyl)benzenesulfonamide (PubChem CID 114616583) has the molecular formula C10H11ClFNO2S and a molecular weight of 263.72 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-(2-methylprop-2-enyl)benzenesulfonamide.
| Compound Name | 4-chloro-2-fluoro-N-(2-methylprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114616583 |
| Molecular Formula | C10H11ClFNO2S |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 4-chloro-2-fluoro-N-(2-methylprop-2-enyl)benzenesulfonamide |
| SMILES | C=C(C)CNS(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C10H11ClFNO2S/c1-7(2)6-13-16(14,15)10-4-3-8(11)5-9(10)12/h3-5,13H,1,6H2,2H3 |
| InChIKey | JDVZCESLALMUOH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|