C11H11ClF3NO2S — CID 114616396
4-chloro-N-(2-methylprop-2-enyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 114616396) has the molecular formula C11H11ClF3NO2S and a molecular weight of 313.73 g/mol. Its IUPAC name is 4-chloro-N-(2-methylprop-2-enyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2-methylprop-2-enyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114616396 |
| Molecular Formula | C11H11ClF3NO2S |
| Molecular Weight | 313.73 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 4-chloro-N-(2-methylprop-2-enyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | C=C(C)CNS(=O)(=O)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NO2S/c1-7(2)6-16-19(17,18)10-4-3-8(12)5-9(10)11(13,14)15/h3-5,16H,1,6H2,2H3 |
| InChIKey | HHFKJEGMLJWNAN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.73 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|