C11H13ClF3NO3S — CID 102697538
4-chloro-N-(2-methoxypropyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 102697538) has the molecular formula C11H13ClF3NO3S and a molecular weight of 331.74 g/mol. Its IUPAC name is 4-chloro-N-(2-methoxypropyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2-methoxypropyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102697538 |
| Molecular Formula | C11H13ClF3NO3S |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 4-chloro-N-(2-methoxypropyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | COC(C)CNS(=O)(=O)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C11H13ClF3NO3S/c1-7(19-2)6-16-20(17,18)10-4-3-8(12)5-9(10)11(13,14)15/h3-5,7,16H,6H2,1-2H3 |
| InChIKey | ZNRZZZUGANMYHT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |