C12H16F3NO3S — CID 102697610
N-(2-methoxypropyl)-2-methyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 102697610) has the molecular formula C12H16F3NO3S and a molecular weight of 311.33 g/mol. Its IUPAC name is N-(2-methoxypropyl)-2-methyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-methoxypropyl)-2-methyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102697610 |
| Molecular Formula | C12H16F3NO3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-(2-methoxypropyl)-2-methyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COC(C)CNS(=O)(=O)c1cccc(C(F)(F)F)c1C |
| InChI | InChI=1S/C12H16F3NO3S/c1-8(19-3)7-16-20(17,18)11-6-4-5-10(9(11)2)12(13,14)15/h4-6,8,16H,7H2,1-3H3 |
| InChIKey | GXFRYOXKYIPFPU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |