C10H14FNO3S — CID 102697449
3-fluoro-N-(2-methoxypropyl)benzenesulfonamide (PubChem CID 102697449) has the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-fluoro-N-(2-methoxypropyl)benzenesulfonamide.
| Compound Name | 3-fluoro-N-(2-methoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102697449 |
| Molecular Formula | C10H14FNO3S |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 3-fluoro-N-(2-methoxypropyl)benzenesulfonamide |
| SMILES | COC(C)CNS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C10H14FNO3S/c1-8(15-2)7-12-16(13,14)10-5-3-4-9(11)6-10/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | MZYAARGEVXTNKO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |