C12H19FN2O3S — CID 102701544
4-fluoro-N-(2-methoxypropyl)-3-(methylaminomethyl)benzenesulfonamide (PubChem CID 102701544) has the molecular formula C12H19FN2O3S and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-fluoro-N-(2-methoxypropyl)-3-(methylaminomethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(2-methoxypropyl)-3-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102701544 |
| Molecular Formula | C12H19FN2O3S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-fluoro-N-(2-methoxypropyl)-3-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCC(C)OC)ccc1F |
| InChI | InChI=1S/C12H19FN2O3S/c1-9(18-3)7-15-19(16,17)11-4-5-12(13)10(6-11)8-14-2/h4-6,9,14-15H,7-8H2,1-3H3 |
| InChIKey | OIHCEUDIBICKST-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |