C12H20FN3O2S — CID 106032493
N-[2-(dimethylamino)ethyl]-4-fluoro-3-(methylaminomethyl)benzenesulfonamide (PubChem CID 106032493) has the molecular formula C12H20FN3O2S and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-fluoro-3-(methylaminomethyl)benzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-fluoro-3-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106032493 |
| Molecular Formula | C12H20FN3O2S |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-fluoro-3-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCCN(C)C)ccc1F |
| InChI | InChI=1S/C12H20FN3O2S/c1-14-9-10-8-11(4-5-12(10)13)19(17,18)15-6-7-16(2)3/h4-5,8,14-15H,6-7,9H2,1-3H3 |
| InChIKey | PXNDTXQAUNCULL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |