C12H19BrFN3O2S — CID 106032600
5-bromo-N-[2-(dimethylamino)ethyl]-2-fluoro-3-(methylaminomethyl)benzenesulfonamide (PubChem CID 106032600) has the molecular formula C12H19BrFN3O2S and a molecular weight of 368.27 g/mol. Its IUPAC name is 5-bromo-N-[2-(dimethylamino)ethyl]-2-fluoro-3-(methylaminomethyl)benzenesulfonamide.
| Compound Name | 5-bromo-N-[2-(dimethylamino)ethyl]-2-fluoro-3-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106032600 |
| Molecular Formula | C12H19BrFN3O2S |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 5-bromo-N-[2-(dimethylamino)ethyl]-2-fluoro-3-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1cc(Br)cc(S(=O)(=O)NCCN(C)C)c1F |
| InChI | InChI=1S/C12H19BrFN3O2S/c1-15-8-9-6-10(13)7-11(12(9)14)20(18,19)16-4-5-17(2)3/h6-7,15-16H,4-5,8H2,1-3H3 |
| InChIKey | SLKVZMYNNJNOMY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |