C9H16BrN5O2S — CID 61299692
5-bromo-N-[2-(dimethylamino)ethyl]-2-hydrazinylpyridine-3-sulfonamide (PubChem CID 61299692) has the molecular formula C9H16BrN5O2S and a molecular weight of 338.23 g/mol. Its IUPAC name is 5-bromo-N-[2-(dimethylamino)ethyl]-2-hydrazinylpyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-[2-(dimethylamino)ethyl]-2-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61299692 |
| Molecular Formula | C9H16BrN5O2S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 5-bromo-N-[2-(dimethylamino)ethyl]-2-hydrazinylpyridine-3-sulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1cc(Br)cnc1NN |
| InChI | InChI=1S/C9H16BrN5O2S/c1-15(2)4-3-13-18(16,17)8-5-7(10)6-12-9(8)14-11/h5-6,13H,3-4,11H2,1-2H3,(H,12,14) |
| InChIKey | RVYOVSVCNSKHMR-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|